Products 1185023-44-2
CAS 1185023-44-2 is the registry number for 2-Amino-3,8-dimethylimidazo(4,5-f)quinoxaline-13C,15N2. Offered by: TRC. Available pack sizes: 25mg.
3,8-dimethyl(213C,1,3-15N2)imidazolo[4,5-f]quinoxalin-2-amine (CAS 1185023-44-2) is a chemical compound with the molecular formula C11H11N5 and a molecular weight of 216.22 g/mol. IUPAC name: 3,8-dimethyl(213C,1,3-15N2)imidazolo[4,5-f]quinoxalin-2-amine. InChIKey: DVCCCQNKIYNAKB-LRPKJYPNSA-N.
| Molecular formula | C11H11N5 |
|---|---|
| Molecular weight | 216.22 g/mol |
| IUPAC name | 3,8-dimethyl(213C,1,3-15N2)imidazolo[4,5-f]quinoxalin-2-amine |
| InChIKey | DVCCCQNKIYNAKB-LRPKJYPNSA-N |
| SMILES | CC1=CN=C2C=CC3=C(C2=N1)[15N]=[13C]([15N]3C)N |
Computed by PubChem (NCBI)