CAS 122457-31-2 appears in our catalog under these names: 2-Amino-3,8-dimethylimidazo(4,5-f)quinoxaline-d3, >95% (HPLC), MeIQx–d3, MeIQx-d3, 99.9%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 5 mg, 1 mg.
8-methyl-3-(trideuteriomethyl)imidazo[4,5-f]quinoxalin-2-amine (CAS 122457-31-2) is a chemical compound with the molecular formula C11H11N5 and a molecular weight of 216.26 g/mol. IUPAC name: 8-methyl-3-(trideuteriomethyl)imidazo[4,5-f]quinoxalin-2-amine. InChIKey: DVCCCQNKIYNAKB-BMSJAHLVSA-N.
| Molecular formula | C11H11N5 |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 8-methyl-3-(trideuteriomethyl)imidazo[4,5-f]quinoxalin-2-amine |
| InChIKey | DVCCCQNKIYNAKB-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N1C2=C(C3=NC(=CN=C3C=C2)C)N=C1N |
Computed by PubChem (NCBI)