Products 1185032-66-9
CAS 1185032-66-9 appears in our catalog under these names: Mephenytoin-d5, rac Mephenytoin-d5, Mephenytoin–d5, Mephenytoin-d5, 98.72%. Offered by: Hubei YoungXin, TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg, 1 mg.
5-ethyl-3-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)imidazolidine-2,4-dione (CAS 1185032-66-9) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 223.28 g/mol. IUPAC name: 5-ethyl-3-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)imidazolidine-2,4-dione. InChIKey: GMHKMTDVRCWUDX-UPKDRLQUSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 223.28 g/mol |
| IUPAC name | 5-ethyl-3-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)imidazolidine-2,4-dione |
| InChIKey | GMHKMTDVRCWUDX-UPKDRLQUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2(C(=O)N(C(=O)N2)C)CC)[2H])[2H] |
Computed by PubChem (NCBI)