Products 1185101-86-3
CAS 1185101-86-3 appears in our catalog under these names: Mephenytoin-d3, rac Mephenytoin-d3, >95% (HPLC). Offered by: Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 2.5 mg, 25 mg.
5-ethyl-5-phenyl-3-(trideuteriomethyl)imidazolidine-2,4-dione (CAS 1185101-86-3) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 221.27 g/mol. IUPAC name: 5-ethyl-5-phenyl-3-(trideuteriomethyl)imidazolidine-2,4-dione. InChIKey: GMHKMTDVRCWUDX-BMSJAHLVSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 221.27 g/mol |
| IUPAC name | 5-ethyl-5-phenyl-3-(trideuteriomethyl)imidazolidine-2,4-dione |
| InChIKey | GMHKMTDVRCWUDX-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=O)C(NC1=O)(CC)C2=CC=CC=C2 |
Computed by PubChem (NCBI)