CAS 71140-51-7 appears in our catalog under these names: (R)-Mephenytoin, >95% (HPLC), (R)-Mephenytoin/ 100%, (R)–Mephenytoin, (R)-MEPHENYTOIN, (R)-Mephenytoin, 99.58%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 100mg, 10mM (in 1ml dmso), 50mg, 2mg, 10mM/1mL.
(5R)-5-ethyl-3-methyl-5-phenylimidazolidine-2,4-dione (CAS 71140-51-7) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: (5R)-5-ethyl-3-methyl-5-phenylimidazolidine-2,4-dione. InChIKey: GMHKMTDVRCWUDX-GFCCVEGCSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | (5R)-5-ethyl-3-methyl-5-phenylimidazolidine-2,4-dione |
| InChIKey | GMHKMTDVRCWUDX-GFCCVEGCSA-N |
| SMILES | CC[C@]1(C(=O)N(C(=O)N1)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)