CAS 1185125-07-8 is the registry number for 2,6-Dichloro-4-nitroaniline-13C6 (Dichloran-13C6). Offered by: TRC. Available pack sizes: 25mg.
2,6-dichloro-4-nitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine (CAS 1185125-07-8) is a chemical compound with the molecular formula C6H4Cl2N2O2 and a molecular weight of 212.97 g/mol. IUPAC name: 2,6-dichloro-4-nitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine. InChIKey: BIXZHMJUSMUDOQ-IDEBNGHGSA-N.
| Molecular formula | C6H4Cl2N2O2 |
|---|---|
| Molecular weight | 212.97 g/mol |
| IUPAC name | 2,6-dichloro-4-nitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine |
| InChIKey | BIXZHMJUSMUDOQ-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13C]([13CH]=[13C]([13C](=[13C]1Cl)N)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)