Products 616865-28-2
CAS 616865-28-2 is the registry number for Chlorzoxazone-13C. Offered by: MedChemExpress. Available pack sizes: 1 mg.
5-chloro-3H-1,3-benzoxazol-2-one (CAS 616865-28-2) is a chemical compound with the molecular formula C7H4ClNO2 and a molecular weight of 170.56 g/mol. IUPAC name: 5-chloro-3H-1,3-benzoxazol-2-one. InChIKey: TZFWDZFKRBELIQ-CDYZYAPPSA-N.
| Molecular formula | C7H4ClNO2 |
|---|---|
| Molecular weight | 170.56 g/mol |
| IUPAC name | 5-chloro-3H-1,3-benzoxazol-2-one |
| InChIKey | TZFWDZFKRBELIQ-CDYZYAPPSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N[13C](=O)O2 |
Computed by PubChem (NCBI)