Products 1185237-80-2
CAS 1185237-80-2 appears in our catalog under these names: 4-Anilinomethylenepentenedioic Acid-d5 5-Methyl Ester, 4–Anilinomethylenepentenedioic Acid–d5 5–Methyl Ester. Offered by: TRC, GLPBio. Available pack sizes: 100mg, 10mg.
(2E,4Z)-4-methoxycarbonyl-5-(2,3,4,5,6-pentadeuterioanilino)penta-2,4-dienoic acid (CAS 1185237-80-2) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 252.28 g/mol. IUPAC name: (2E,4Z)-4-methoxycarbonyl-5-(2,3,4,5,6-pentadeuterioanilino)penta-2,4-dienoic acid. InChIKey: FJKGPQZCFBLFIG-GBDHNZSISA-N.
| Molecular formula | C13H13NO4 |
|---|---|
| Molecular weight | 252.28 g/mol |
| IUPAC name | (2E,4Z)-4-methoxycarbonyl-5-(2,3,4,5,6-pentadeuterioanilino)penta-2,4-dienoic acid |
| InChIKey | FJKGPQZCFBLFIG-GBDHNZSISA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])N/C=C(/C=C/C(=O)O)\C(=O)OC)[2H])[2H] |
Computed by PubChem (NCBI)