Products 64972-00-5

CAS 64972-00-5 is the registry number for 4-((Phenylamino)methylene)-2-pentenedioic Acid 5-Methyl Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

(2E,4Z)-5-anilino-4-methoxycarbonylpenta-2,4-dienoic acid (CAS 64972-00-5) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: (2E,4Z)-5-anilino-4-methoxycarbonylpenta-2,4-dienoic acid. InChIKey: FJKGPQZCFBLFIG-GOJKSUSPSA-N.

Identity
Molecular formulaC13H13NO4
Molecular weight247.25 g/mol
IUPAC name(2E,4Z)-5-anilino-4-methoxycarbonylpenta-2,4-dienoic acid
InChIKeyFJKGPQZCFBLFIG-GOJKSUSPSA-N
SMILESCOC(=O)/C(=C\NC1=CC=CC=C1)/C=C/C(=O)O

Computed by PubChem (NCBI)