CAS 64972-00-5 is the registry number for 4-((Phenylamino)methylene)-2-pentenedioic Acid 5-Methyl Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
(2E,4Z)-5-anilino-4-methoxycarbonylpenta-2,4-dienoic acid (CAS 64972-00-5) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: (2E,4Z)-5-anilino-4-methoxycarbonylpenta-2,4-dienoic acid. InChIKey: FJKGPQZCFBLFIG-GOJKSUSPSA-N.
| Molecular formula | C13H13NO4 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | (2E,4Z)-5-anilino-4-methoxycarbonylpenta-2,4-dienoic acid |
| InChIKey | FJKGPQZCFBLFIG-GOJKSUSPSA-N |
| SMILES | COC(=O)/C(=C\NC1=CC=CC=C1)/C=C/C(=O)O |
Computed by PubChem (NCBI)