CAS 1185241-38-6 appears in our catalog under these names: 3-(3,4-Dimethoxyphenyl)acrylic-13C3 acid, 98%, 3,4-Dimethoxy(7,8,9,-13C3)-cinnamic Acid, (E)-3,4-Dimethoxycinnamic acid-13C3. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 2,5mg, 25mg, 25 mg, 2.5 mg.
(E)-3-(3,4-dimethoxyphenyl)(1,2,3-13C3)prop-2-enoic acid (CAS 1185241-38-6) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 211.19 g/mol. IUPAC name: (E)-3-(3,4-dimethoxyphenyl)(1,2,3-13C3)prop-2-enoic acid. InChIKey: HJBWJAPEBGSQPR-MELSJBJPSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 211.19 g/mol |
| IUPAC name | (E)-3-(3,4-dimethoxyphenyl)(1,2,3-13C3)prop-2-enoic acid |
| InChIKey | HJBWJAPEBGSQPR-MELSJBJPSA-N |
| SMILES | COC1=C(C=C(C=C1)/[13CH]=[13CH]/[13C](=O)O)OC |
Computed by PubChem (NCBI)