CAS 1185243-77-9 appears in our catalog under these names: 4-{((p-Fluorophenyl)imino)methyl}phenol-d4, 4-[[(4-Fluorophenyl)imino]methyl]phenol-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 10 mg, 100 mg.
4-[(2,3,5,6-tetradeuterio-4-fluorophenyl)iminomethyl]phenol (CAS 1185243-77-9) is a chemical compound with the molecular formula C13H10FNO and a molecular weight of 219.25 g/mol. IUPAC name: 4-[(2,3,5,6-tetradeuterio-4-fluorophenyl)iminomethyl]phenol. InChIKey: VNNJGDYPPLXJFF-LNFUJOGGSA-N.
| Molecular formula | C13H10FNO |
|---|---|
| Molecular weight | 219.25 g/mol |
| IUPAC name | 4-[(2,3,5,6-tetradeuterio-4-fluorophenyl)iminomethyl]phenol |
| InChIKey | VNNJGDYPPLXJFF-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N=CC2=CC=C(C=C2)O)[2H])[2H])F)[2H] |
Computed by PubChem (NCBI)