CAS 942485-62-3 appears in our catalog under these names: (E)-4-(((4-Fluorophenyl)imino)methyl)phenol 98%, (E)-4-(((4-Fluorophenyl)imino)methyl)phenol, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 25g, 100g, 500g, 1000g.
4-[(4-fluorophenyl)iminomethyl]phenol (CAS 942485-62-3) is a chemical compound with the molecular formula C13H10FNO and a molecular weight of 215.22 g/mol. IUPAC name: 4-[(4-fluorophenyl)iminomethyl]phenol. InChIKey: VNNJGDYPPLXJFF-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO |
|---|---|
| Molecular weight | 215.22 g/mol |
| IUPAC name | 4-[(4-fluorophenyl)iminomethyl]phenol |
| InChIKey | VNNJGDYPPLXJFF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=NC2=CC=C(C=C2)F)O |
Computed by PubChem (NCBI)