Products 438624-69-2
CAS 438624-69-2 appears in our catalog under these names: 4-{((p-Fluorophenyl)imino)methyl}phenol-13C6, 4-[[(4-Fluorophenyl)imino]methyl]phenol-13C6. Offered by: TRC, MedChemExpress. Available pack sizes: 1mg, 2,5mg, 5mg, 2.5 mg, 1 mg, 5 mg.
4-[(4-fluorophenyl)iminomethyl](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol (CAS 438624-69-2) is a chemical compound with the molecular formula C13H10FNO and a molecular weight of 221.18 g/mol. IUPAC name: 4-[(4-fluorophenyl)iminomethyl](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol. InChIKey: VNNJGDYPPLXJFF-WCAZBZEQSA-N.
| Molecular formula | C13H10FNO |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | 4-[(4-fluorophenyl)iminomethyl](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol |
| InChIKey | VNNJGDYPPLXJFF-WCAZBZEQSA-N |
| SMILES | C1=CC(=CC=C1N=C[13C]2=[13CH][13CH]=[13C]([13CH]=[13CH]2)O)F |
Computed by PubChem (NCBI)