Products 1185296-60-9

CAS 1185296-60-9 is the registry number for Fmoc-2-amino-5-fluorobenzoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-fluorobenzoic acid (CAS 1185296-60-9) is a chemical compound with the molecular formula C22H16FNO4 and a molecular weight of 377.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-fluorobenzoic acid. InChIKey: WSVXSPJFKVBMET-UHFFFAOYSA-N.

Identity
Molecular formulaC22H16FNO4
Molecular weight377.4 g/mol
IUPAC name2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-fluorobenzoic acid
InChIKeyWSVXSPJFKVBMET-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=C(C=C(C=C4)F)C(=O)O

Computed by PubChem (NCBI)