Products 1485218-64-1

CAS 1485218-64-1 is the registry number for 2-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)-3-fluorobenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-fluorobenzoic acid (CAS 1485218-64-1) is a chemical compound with the molecular formula C22H16FNO4 and a molecular weight of 377.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-fluorobenzoic acid. InChIKey: ZMRIBALTOWHSDV-UHFFFAOYSA-N.

Identity
Molecular formulaC22H16FNO4
Molecular weight377.4 g/mol
IUPAC name2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-fluorobenzoic acid
InChIKeyZMRIBALTOWHSDV-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=C(C=CC=C4F)C(=O)O

Computed by PubChem (NCBI)