CAS 1339407-92-9 appears in our catalog under these names: 3-{((9H-fluoren-9-ylmethoxy)carbonyl)amino}-4-fluorobenzoic acid, 95%, 3-{((9H-Fluoren-9-ylmethoxy)carbonyl)amino}-4-fluorobenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-fluorobenzoic acid (CAS 1339407-92-9) is a chemical compound with the molecular formula C22H16FNO4 and a molecular weight of 377.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-fluorobenzoic acid. InChIKey: SHTPNLJACINZNG-UHFFFAOYSA-N.
| Molecular formula | C22H16FNO4 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-fluorobenzoic acid |
| InChIKey | SHTPNLJACINZNG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=C(C=CC(=C4)C(=O)O)F |
Computed by PubChem (NCBI)