CAS 942191-15-3 is the registry number for 3-(Carboxymethyl)-5-fluoro-1-(naphthalen-1-ylmethyl)-1h-indole-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
3-(carboxymethyl)-5-fluoro-1-(naphthalen-1-ylmethyl)indole-2-carboxylic acid (CAS 942191-15-3) is a chemical compound with the molecular formula C22H16FNO4 and a molecular weight of 377.4 g/mol. IUPAC name: 3-(carboxymethyl)-5-fluoro-1-(naphthalen-1-ylmethyl)indole-2-carboxylic acid. InChIKey: AASYYGYJPZBFKC-UHFFFAOYSA-N.
| Molecular formula | C22H16FNO4 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | 3-(carboxymethyl)-5-fluoro-1-(naphthalen-1-ylmethyl)indole-2-carboxylic acid |
| InChIKey | AASYYGYJPZBFKC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2CN3C4=C(C=C(C=C4)F)C(=C3C(=O)O)CC(=O)O |
Computed by PubChem (NCBI)