CAS 1185298-00-3 is the registry number for 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-fluorobenzoic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-fluorobenzoic acid (CAS 1185298-00-3) is a chemical compound with the molecular formula C22H16FNO4 and a molecular weight of 377.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-fluorobenzoic acid. InChIKey: PHESMLXNPOVJQL-UHFFFAOYSA-N.
| Molecular formula | C22H16FNO4 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-fluorobenzoic acid |
| InChIKey | PHESMLXNPOVJQL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=C(C=CC(=C4)F)C(=O)O |
Computed by PubChem (NCBI)