Products 1185299-18-6

CAS 1185299-18-6 is the registry number for 3-(4,5,6,7-Tetrahydro-2h-indazol-3-yl)propanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 5g, 1g.

Structural formula: {0} (CAS {1})

3-(4,5,6,7-tetrahydro-1H-indazol-3-yl)propanoic acid;hydrochloride (CAS 1185299-18-6) is a chemical compound with the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. IUPAC name: 3-(4,5,6,7-tetrahydro-1H-indazol-3-yl)propanoic acid;hydrochloride. InChIKey: HTDUNWLWLYAYIR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15ClN2O2
Molecular weight230.69 g/mol
IUPAC name3-(4,5,6,7-tetrahydro-1H-indazol-3-yl)propanoic acid;hydrochloride
InChIKeyHTDUNWLWLYAYIR-UHFFFAOYSA-N
SMILESC1CCC2=C(C1)C(=NN2)CCC(=O)O.Cl

Computed by PubChem (NCBI)