CAS 1810074-68-0 appears in our catalog under these names: (S)-Methyl 2-amino-3-(5-methylpyridin-2-yl)propanoate hydrochloride, 95%, (S)–Methyl 2–amino–3–(5–methylpyridin–2–yl)propanoate hydrochloride, (S)-Methyl 2-amino-3-(5-methylpyridin-2-yl)propanoate hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl (2S)-2-amino-3-(5-methyl-2-pyridinyl)propanoate;hydrochloride (CAS 1810074-68-0) is a chemical compound with the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. IUPAC name: methyl (2S)-2-amino-3-(5-methyl-2-pyridinyl)propanoate;hydrochloride. InChIKey: IFSWKHKYYJANIQ-FVGYRXGTSA-N.
| Molecular formula | C10H15ClN2O2 |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(5-methyl-2-pyridinyl)propanoate;hydrochloride |
| InChIKey | IFSWKHKYYJANIQ-FVGYRXGTSA-N |
| SMILES | CC1=CN=C(C=C1)C[C@@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)