Products 1197542-76-9
CAS 1197542-76-9 appears in our catalog under these names: Ethyl n-(4-aminophenyl)-n-methylcarbamate hydrochloride, 95%, Ethyl N-(4-aminophenyl)-N-methylcarbamate hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
Ethyl N-(4-aminophenyl)-N-methylcarbamate;hydrochloride (CAS 1197542-76-9) is a chemical compound with the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. IUPAC name: ethyl N-(4-aminophenyl)-N-methylcarbamate;hydrochloride. InChIKey: MRPYQALSMVSQAC-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O2 |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | ethyl N-(4-aminophenyl)-N-methylcarbamate;hydrochloride |
| InChIKey | MRPYQALSMVSQAC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N(C)C1=CC=C(C=C1)N.Cl |
Computed by PubChem (NCBI)