Products 1185302-10-6

CAS 1185302-10-6 is the registry number for Ethyl 3-hydrazino-4-methylbenzoate hydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 3-hydrazinyl-4-methylbenzoate;hydrochloride (CAS 1185302-10-6) is a chemical compound with the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. IUPAC name: ethyl 3-hydrazinyl-4-methylbenzoate;hydrochloride. InChIKey: BAKCTIHVWUYIQX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15ClN2O2
Molecular weight230.69 g/mol
IUPAC nameethyl 3-hydrazinyl-4-methylbenzoate;hydrochloride
InChIKeyBAKCTIHVWUYIQX-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=C(C=C1)C)NN.Cl

Computed by PubChem (NCBI)