CAS 25953-06-4 appears in our catalog under these names: 2-Nitroso-5-diethylaminophenol hydrochloride, 95%, 5-(Diethylamino)-2-nitrosophenol Hydrochloride, 5–Diethylamino–2–nitrosophenol Hydrochloride, 5-(Diethylamino)-2-nitrosophenol hydrochloride, 98%, 5-(Diethylamino)-2-nitrosophenol hydrochloride, 95%. Offered by: Combi-blocks, TRC, GLPBio, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 1g, 2,5g, 25g.
5-(diethylamino)-2-nitrosophenol;hydrochloride (CAS 25953-06-4) is a chemical compound with the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. IUPAC name: 5-(diethylamino)-2-nitrosophenol;hydrochloride. InChIKey: JFOYWYLGEUIHOJ-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O2 |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 5-(diethylamino)-2-nitrosophenol;hydrochloride |
| InChIKey | JFOYWYLGEUIHOJ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC(=C(C=C1)N=O)O.Cl |
Computed by PubChem (NCBI)