Products 1185299-51-7

CAS 1185299-51-7 is the registry number for 1-(2-NAPHTHYLMETHYL)PIPERIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

1-(naphthalen-2-ylmethyl)piperidine-3-carboxylic acid;hydrochloride (CAS 1185299-51-7) is a chemical compound with the molecular formula C17H20ClNO2 and a molecular weight of 305.8 g/mol. IUPAC name: 1-(naphthalen-2-ylmethyl)piperidine-3-carboxylic acid;hydrochloride. InChIKey: FKMHDONGVLXODM-UHFFFAOYSA-N.

Identity
Molecular formulaC17H20ClNO2
Molecular weight305.8 g/mol
IUPAC name1-(naphthalen-2-ylmethyl)piperidine-3-carboxylic acid;hydrochloride
InChIKeyFKMHDONGVLXODM-UHFFFAOYSA-N
SMILESC1CC(CN(C1)CC2=CC3=CC=CC=C3C=C2)C(=O)O.Cl

Computed by PubChem (NCBI)