CAS 1185299-51-7 is the registry number for 1-(2-NAPHTHYLMETHYL)PIPERIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(naphthalen-2-ylmethyl)piperidine-3-carboxylic acid;hydrochloride (CAS 1185299-51-7) is a chemical compound with the molecular formula C17H20ClNO2 and a molecular weight of 305.8 g/mol. IUPAC name: 1-(naphthalen-2-ylmethyl)piperidine-3-carboxylic acid;hydrochloride. InChIKey: FKMHDONGVLXODM-UHFFFAOYSA-N.
| Molecular formula | C17H20ClNO2 |
|---|---|
| Molecular weight | 305.8 g/mol |
| IUPAC name | 1-(naphthalen-2-ylmethyl)piperidine-3-carboxylic acid;hydrochloride |
| InChIKey | FKMHDONGVLXODM-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=CC3=CC=CC=C3C=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)