Products 142350-27-4
CAS 142350-27-4 is the registry number for 2,2-Dibenzyl-5-hydroxy-1,2-oxazolidin-2-ium chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,2-dibenzyl-1,2-oxazolidin-2-ium-5-ol chloride (CAS 142350-27-4) is a chemical compound with the molecular formula C17H20ClNO2 and a molecular weight of 305.8 g/mol. IUPAC name: 2,2-dibenzyl-1,2-oxazolidin-2-ium-5-ol chloride. InChIKey: PSDNFZHVEGJIRI-UHFFFAOYSA-M.
| Molecular formula | C17H20ClNO2 |
|---|---|
| Molecular weight | 305.8 g/mol |
| IUPAC name | 2,2-dibenzyl-1,2-oxazolidin-2-ium-5-ol chloride |
| InChIKey | PSDNFZHVEGJIRI-UHFFFAOYSA-M |
| SMILES | C1C[N+](OC1O)(CC2=CC=CC=C2)CC3=CC=CC=C3.[Cl-] |
Computed by PubChem (NCBI)