Products 24620-67-5
CAS 24620-67-5 is the registry number for Methylapogalanthamine. Offered by: Biosynth. Available pack sizes: 250mg.
4-methoxy-9-methyl-9-azoniatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-3-ol chloride (CAS 24620-67-5) is a chemical compound with the molecular formula C17H20ClNO2 and a molecular weight of 305.8 g/mol. IUPAC name: 4-methoxy-9-methyl-9-azoniatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-3-ol chloride. InChIKey: KIVTXMKWQLVGKL-UHFFFAOYSA-N.
| Molecular formula | C17H20ClNO2 |
|---|---|
| Molecular weight | 305.8 g/mol |
| IUPAC name | 4-methoxy-9-methyl-9-azoniatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-3-ol chloride |
| InChIKey | KIVTXMKWQLVGKL-UHFFFAOYSA-N |
| SMILES | C[NH+]1CCC2=CC=CC=C2C3=C(C1)C=CC(=C3O)OC.[Cl-] |
Computed by PubChem (NCBI)