Products 1329063-33-3

CAS 1329063-33-3 is the registry number for Benzyl (S)-3-amino-4-phenylbutanoate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Benzyl 3-amino-4-phenylbutanoate;hydrochloride (CAS 1329063-33-3) is a chemical compound with the molecular formula C17H20ClNO2 and a molecular weight of 305.8 g/mol. IUPAC name: benzyl 3-amino-4-phenylbutanoate;hydrochloride. InChIKey: OHOVBGRGMBZUOX-UHFFFAOYSA-N.

Identity
Molecular formulaC17H20ClNO2
Molecular weight305.8 g/mol
IUPAC namebenzyl 3-amino-4-phenylbutanoate;hydrochloride
InChIKeyOHOVBGRGMBZUOX-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CC(CC(=O)OCC2=CC=CC=C2)N.Cl

Computed by PubChem (NCBI)