CAS 84028-90-0 appears in our catalog under these names: Bzl-d-phe-ome hydrochloride, 95%, Bzl-D-Phe-OMe*HCl. Offered by: Combi-blocks, Creative Peptides, Iris Biotech. Available pack sizes: 5g, 1g, 25g, 250mg.
Methyl (2R)-2-(benzylamino)-3-phenylpropanoate;hydrochloride (CAS 84028-90-0) is a chemical compound with the molecular formula C17H20ClNO2 and a molecular weight of 305.8 g/mol. IUPAC name: methyl (2R)-2-(benzylamino)-3-phenylpropanoate;hydrochloride. InChIKey: FKTZZMDPUTVSOH-PKLMIRHRSA-N.
| Molecular formula | C17H20ClNO2 |
|---|---|
| Molecular weight | 305.8 g/mol |
| IUPAC name | methyl (2R)-2-(benzylamino)-3-phenylpropanoate;hydrochloride |
| InChIKey | FKTZZMDPUTVSOH-PKLMIRHRSA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=CC=C1)NCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)