CAS 90253-98-8 appears in our catalog under these names: 2-Amino-3',4'-dimethoxypropiophenone hydrochloride, 95%, 2-Amino-3',4'-dimethoxypropiophenone Hydrochloride. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 500mg, 1000mg, 2000mg.
2-amino-1-(3,4-dimethoxyphenyl)propan-1-one;hydrochloride (CAS 90253-98-8) is a chemical compound with the molecular formula C11H16ClNO3 and a molecular weight of 245.70 g/mol. IUPAC name: 2-amino-1-(3,4-dimethoxyphenyl)propan-1-one;hydrochloride. InChIKey: CFRSIBSRFOZTSN-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO3 |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | 2-amino-1-(3,4-dimethoxyphenyl)propan-1-one;hydrochloride |
| InChIKey | CFRSIBSRFOZTSN-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=C(C=C1)OC)OC)N.Cl |
Computed by PubChem (NCBI)