CAS 152237-41-7 is the registry number for Dropropizine N,N-Dioxide. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1,4-dioxido-4-phenylpiperazine-1,4-diium-1-yl)propane-1,2-diol (CAS 152237-41-7) is a chemical compound with the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. IUPAC name: 3-(1,4-dioxido-4-phenylpiperazine-1,4-diium-1-yl)propane-1,2-diol. InChIKey: ORQHBRZAGJIZCU-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O4 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | 3-(1,4-dioxido-4-phenylpiperazine-1,4-diium-1-yl)propane-1,2-diol |
| InChIKey | ORQHBRZAGJIZCU-UHFFFAOYSA-N |
| SMILES | C1C[N+](CC[N+]1(CC(CO)O)[O-])(C2=CC=CC=C2)[O-] |
Computed by PubChem (NCBI)