CAS 1185316-61-3 is the registry number for Piperazin-1-yl(thiophen-3-yl)methanone hydrochloride. Offered by: Chemat. Available pack sizes: 500mg.
Piperazin-1-yl(thiophen-3-yl)methanone;hydrochloride (CAS 1185316-61-3) is a chemical compound with the molecular formula C9H13ClN2OS and a molecular weight of 232.73 g/mol. IUPAC name: piperazin-1-yl(thiophen-3-yl)methanone;hydrochloride. InChIKey: KHNUGOQLFYSKDK-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2OS |
|---|---|
| Molecular weight | 232.73 g/mol |
| IUPAC name | piperazin-1-yl(thiophen-3-yl)methanone;hydrochloride |
| InChIKey | KHNUGOQLFYSKDK-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CSC=C2.Cl |
Computed by PubChem (NCBI)