Products 348138-15-8
CAS 348138-15-8 is the registry number for 1-[(4,6-Dimethyl-2-pyrimidinyl)thio]acetone hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(4,6-dimethylpyrimidin-2-yl)sulfanylpropan-2-one;hydrochloride (CAS 348138-15-8) is a chemical compound with the molecular formula C9H13ClN2OS and a molecular weight of 232.73 g/mol. IUPAC name: 1-(4,6-dimethylpyrimidin-2-yl)sulfanylpropan-2-one;hydrochloride. InChIKey: QONOYDDROAGBCS-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2OS |
|---|---|
| Molecular weight | 232.73 g/mol |
| IUPAC name | 1-(4,6-dimethylpyrimidin-2-yl)sulfanylpropan-2-one;hydrochloride |
| InChIKey | QONOYDDROAGBCS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)SCC(=O)C)C.Cl |
Computed by PubChem (NCBI)