CAS 1431962-19-4 is the registry number for 1-{4-Methyl-2-((prop-2-en-1-yl)amino)-1,3-thiazol-5-yl}ethan-1-one hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-[4-methyl-2-(prop-2-enylamino)-1,3-thiazol-5-yl]ethanone;hydrochloride (CAS 1431962-19-4) is a chemical compound with the molecular formula C9H13ClN2OS and a molecular weight of 232.73 g/mol. IUPAC name: 1-[4-methyl-2-(prop-2-enylamino)-1,3-thiazol-5-yl]ethanone;hydrochloride. InChIKey: BHUHDZDKAOMKKE-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2OS |
|---|---|
| Molecular weight | 232.73 g/mol |
| IUPAC name | 1-[4-methyl-2-(prop-2-enylamino)-1,3-thiazol-5-yl]ethanone;hydrochloride |
| InChIKey | BHUHDZDKAOMKKE-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NCC=C)C(=O)C.Cl |
Computed by PubChem (NCBI)