CAS 1251925-33-3 appears in our catalog under these names: 1-[(4-Aminophenyl)sulfanyl]-n,n-dimethylformamide hydrochloride, 95%, 1-((4-Aminophenyl)sulfanyl)-N,N-dimethylformamide hydrochloride, 95%, 1-((4-Aminophenyl)sulfanyl)-N,N-dimethylformamide hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
S-(4-aminophenyl) N,N-dimethylcarbamothioate;hydrochloride (CAS 1251925-33-3) is a chemical compound with the molecular formula C9H13ClN2OS and a molecular weight of 232.73 g/mol. IUPAC name: S-(4-aminophenyl) N,N-dimethylcarbamothioate;hydrochloride. InChIKey: WMMCDPJCWFYENC-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2OS |
|---|---|
| Molecular weight | 232.73 g/mol |
| IUPAC name | S-(4-aminophenyl) N,N-dimethylcarbamothioate;hydrochloride |
| InChIKey | WMMCDPJCWFYENC-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)SC1=CC=C(C=C1)N.Cl |
Computed by PubChem (NCBI)