Products 25985-08-4

CAS 25985-08-4 is the registry number for 4-Methoxybenzyl imidothiocarbamate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

(4-methoxyphenyl)methyl carbamimidothioate;hydrochloride (CAS 25985-08-4) is a chemical compound with the molecular formula C9H13ClN2OS and a molecular weight of 232.73 g/mol. IUPAC name: (4-methoxyphenyl)methyl carbamimidothioate;hydrochloride. InChIKey: QGNMUFKTLKVUHM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13ClN2OS
Molecular weight232.73 g/mol
IUPAC name(4-methoxyphenyl)methyl carbamimidothioate;hydrochloride
InChIKeyQGNMUFKTLKVUHM-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)CSC(=N)N.Cl

Computed by PubChem (NCBI)