CAS 1185318-64-2 is the registry number for 1–Chloro–4–(methoxy–d3)–phthalazine. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
1-chloro-4-(trideuteriomethoxy)phthalazine (CAS 1185318-64-2) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 197.63 g/mol. IUPAC name: 1-chloro-4-(trideuteriomethoxy)phthalazine. InChIKey: GWYZIDACSVOFQB-FIBGUPNXSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 197.63 g/mol |
| IUPAC name | 1-chloro-4-(trideuteriomethoxy)phthalazine |
| InChIKey | GWYZIDACSVOFQB-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=NN=C(C2=CC=CC=C21)Cl |
Computed by PubChem (NCBI)