CAS 1185460-15-4 is the registry number for N-(4-Amino-2-chlorophenyl)-2,2-dimethylpropanamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-(4-amino-2-chlorophenyl)-2,2-dimethylpropanamide;hydrochloride (CAS 1185460-15-4) is a chemical compound with the molecular formula C11H16Cl2N2O and a molecular weight of 263.16 g/mol. IUPAC name: N-(4-amino-2-chlorophenyl)-2,2-dimethylpropanamide;hydrochloride. InChIKey: NHZUETRVEZTSCP-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl2N2O |
|---|---|
| Molecular weight | 263.16 g/mol |
| IUPAC name | N-(4-amino-2-chlorophenyl)-2,2-dimethylpropanamide;hydrochloride |
| InChIKey | NHZUETRVEZTSCP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=C(C=C1)N)Cl.Cl |
Computed by PubChem (NCBI)