Products 2044703-04-8
CAS 2044703-04-8 appears in our catalog under these names: 4-Amino-1-benzylpyrrolidin-2-one dihydrochloride, 95%, 4–Amino–1–benzylpyrrolidin–2–one dihydrochloride, 4-Amino-1-benzylpyrrolidin-2-one dihydrochloride, 98%, 98%, 4-Amino-1-benzylpyrrolidin-2-one dihydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
4-amino-1-benzylpyrrolidin-2-one;dihydrochloride (CAS 2044703-04-8) is a chemical compound with the molecular formula C11H16Cl2N2O and a molecular weight of 263.16 g/mol. IUPAC name: 4-amino-1-benzylpyrrolidin-2-one;dihydrochloride. InChIKey: WDLMCJLUPOMUSD-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl2N2O |
|---|---|
| Molecular weight | 263.16 g/mol |
| IUPAC name | 4-amino-1-benzylpyrrolidin-2-one;dihydrochloride |
| InChIKey | WDLMCJLUPOMUSD-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)CC2=CC=CC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)