CAS 1301738-69-1 is the registry number for 3-Piperidinyl(3-pyridinyl)methanone dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Piperidin-3-yl(pyridin-3-yl)methanone;dihydrochloride (CAS 1301738-69-1) is a chemical compound with the molecular formula C11H16Cl2N2O and a molecular weight of 263.16 g/mol. IUPAC name: piperidin-3-yl(pyridin-3-yl)methanone;dihydrochloride. InChIKey: JLMGPDAQJNHIAN-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl2N2O |
|---|---|
| Molecular weight | 263.16 g/mol |
| IUPAC name | piperidin-3-yl(pyridin-3-yl)methanone;dihydrochloride |
| InChIKey | JLMGPDAQJNHIAN-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C(=O)C2=CN=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)