CAS 1881290-51-2 is the registry number for 3-amino-5-chloro-N,N-diethylbenzamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-amino-5-chloro-N,N-diethylbenzamide;hydrochloride (CAS 1881290-51-2) is a chemical compound with the molecular formula C11H16Cl2N2O and a molecular weight of 263.16 g/mol. IUPAC name: 3-amino-5-chloro-N,N-diethylbenzamide;hydrochloride. InChIKey: HDFSDJDMEGUQDD-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl2N2O |
|---|---|
| Molecular weight | 263.16 g/mol |
| IUPAC name | 3-amino-5-chloro-N,N-diethylbenzamide;hydrochloride |
| InChIKey | HDFSDJDMEGUQDD-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC(=CC(=C1)Cl)N.Cl |
Computed by PubChem (NCBI)