Products 286464-49-1

CAS 286464-49-1 is the registry number for 1-(5-Chloro-2-methoxyphenyl)piperazine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g, 10g.

Structural formula: {0} (CAS {1})

1-(5-chloro-2-methoxyphenyl)piperazine;hydrochloride (CAS 286464-49-1) is a chemical compound with the molecular formula C11H16Cl2N2O and a molecular weight of 263.16 g/mol. IUPAC name: 1-(5-chloro-2-methoxyphenyl)piperazine;hydrochloride. InChIKey: NTLFAHFTZBIIPG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16Cl2N2O
Molecular weight263.16 g/mol
IUPAC name1-(5-chloro-2-methoxyphenyl)piperazine;hydrochloride
InChIKeyNTLFAHFTZBIIPG-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)Cl)N2CCNCC2.Cl

Computed by PubChem (NCBI)