Products 1185693-68-8
CAS 1185693-68-8 is the registry number for [3-(1H-Indol-1-yl)propyl]amine methanesulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.
3-indol-1-ylpropan-1-amine;methanesulfonic acid (CAS 1185693-68-8) is a chemical compound with the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. IUPAC name: 3-indol-1-ylpropan-1-amine;methanesulfonic acid. InChIKey: QHOYTGAGZATHEK-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O3S |
|---|---|
| Molecular weight | 270.35 g/mol |
| IUPAC name | 3-indol-1-ylpropan-1-amine;methanesulfonic acid |
| InChIKey | QHOYTGAGZATHEK-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.C1=CC=C2C(=C1)C=CN2CCCN |
Computed by PubChem (NCBI)
Synonyms:
3-(1H-Indol-1-yl)propan-1-amine methanesulfonate, [3-(1H-Indol-1-yl)propyl]amine methanesulfonate, 3-indol-1-ylpropan-1-amine;methanesulfonic acid, [3-(1H-Indol-1-yl)propyl]aminemethanesulfonate, 3-(1H-indol-1-yl)propan-1-amine; methanesulfonic acid, 3-(1H-Indol-1-yl)propan-1-amine methanesulfonate, AldrichCPR