CAS 750607-99-9 appears in our catalog under these names: 4-[(2,6-Dimethylmorpholin-4-yl)sulfonyl]aniline, 95%, 4-((2,6-Dimethylmorpholin-4-yl)sulfonyl)aniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 10g.
4-(2,6-dimethylmorpholin-4-yl)sulfonylaniline (CAS 750607-99-9) is a chemical compound with the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. IUPAC name: 4-(2,6-dimethylmorpholin-4-yl)sulfonylaniline. InChIKey: ZHDKFRBHCZXAJB-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O3S |
|---|---|
| Molecular weight | 270.35 g/mol |
| IUPAC name | 4-(2,6-dimethylmorpholin-4-yl)sulfonylaniline |
| InChIKey | ZHDKFRBHCZXAJB-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(O1)C)S(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)