CAS 884504-70-5 appears in our catalog under these names: 1-((4-(tert-Butyl)phenyl)sulfonyl)-2-(hydroxyimino)eth-2-ylamine, 95%, 1-((4-(tert-Butyl)phenyl)sulfonyl)-2-(hydroxyimino)eth-2-ylamine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 25g.
2-(4-tert-butylphenyl)sulfonyl-N'-hydroxyethanimidamide (CAS 884504-70-5) is a chemical compound with the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. IUPAC name: 2-(4-tert-butylphenyl)sulfonyl-N'-hydroxyethanimidamide. InChIKey: PBCNZDGBLRFBKQ-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O3S |
|---|---|
| Molecular weight | 270.35 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)sulfonyl-N'-hydroxyethanimidamide |
| InChIKey | PBCNZDGBLRFBKQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)S(=O)(=O)C/C(=N/O)/N |
Computed by PubChem (NCBI)