CAS 852214-23-4 is the registry number for N-(3-(N,N-Dimethylsulfamoyl)phenyl)butyramide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[3-(dimethylsulfamoyl)phenyl]butanamide (CAS 852214-23-4) is a chemical compound with the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. IUPAC name: N-[3-(dimethylsulfamoyl)phenyl]butanamide. InChIKey: LUPKIPCBOIFQHX-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O3S |
|---|---|
| Molecular weight | 270.35 g/mol |
| IUPAC name | N-[3-(dimethylsulfamoyl)phenyl]butanamide |
| InChIKey | LUPKIPCBOIFQHX-UHFFFAOYSA-N |
| SMILES | CCCC(=O)NC1=CC(=CC=C1)S(=O)(=O)N(C)C |
Computed by PubChem (NCBI)