Products 1712677-79-6
CAS 1712677-79-6 appears in our catalog under these names: Articaine EP Impurity A, Articaine Impurity 1(Articaine EP Impurity A）, Methyl 4-methyl-3-(2-(propylamino)acetamido)thiophene-2-carboxylate. Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl 4-methyl-3-[[2-(propylamino)acetyl]amino]thiophene-2-carboxylate (CAS 1712677-79-6) is a chemical compound with the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. IUPAC name: methyl 4-methyl-3-[[2-(propylamino)acetyl]amino]thiophene-2-carboxylate. InChIKey: DSGKAUAFDAOGME-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O3S |
|---|---|
| Molecular weight | 270.35 g/mol |
| IUPAC name | methyl 4-methyl-3-[[2-(propylamino)acetyl]amino]thiophene-2-carboxylate |
| InChIKey | DSGKAUAFDAOGME-UHFFFAOYSA-N |
| SMILES | CCCNCC(=O)NC1=C(SC=C1C)C(=O)OC |
Computed by PubChem (NCBI)