CAS 118584-19-3 appears in our catalog under these names: 7–(6'R–hydroxy–3',7'–dimethylocta–2',7'–dienyloxy)coumarin, 7-(6'R-Hydroxy-3',7'-dimethylocta-2',7'-dienyloxy)coumarin. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
7-[(2E,6R)-6-hydroxy-3,7-dimethylocta-2,7-dienoxy]chromen-2-one (CAS 118584-19-3) is a chemical compound with the molecular formula C19H22O4 and a molecular weight of 314.4 g/mol. IUPAC name: 7-[(2E,6R)-6-hydroxy-3,7-dimethylocta-2,7-dienoxy]chromen-2-one. InChIKey: OWAQHJLCKMIPKB-IDKBZEPQSA-N.
| Molecular formula | C19H22O4 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | 7-[(2E,6R)-6-hydroxy-3,7-dimethylocta-2,7-dienoxy]chromen-2-one |
| InChIKey | OWAQHJLCKMIPKB-IDKBZEPQSA-N |
| SMILES | CC(=C)[C@@H](CC/C(=C/COC1=CC2=C(C=C1)C=CC(=O)O2)/C)O |
Computed by PubChem (NCBI)