Products 53530-24-8

CAS 53530-24-8 is the registry number for Benzyl 2,4-dihydroxy-6-pentylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Benzyl 2,4-dihydroxy-6-pentylbenzoate (CAS 53530-24-8) is a chemical compound with the molecular formula C19H22O4 and a molecular weight of 314.4 g/mol. IUPAC name: benzyl 2,4-dihydroxy-6-pentylbenzoate. InChIKey: FURJJYWNPJDYDH-UHFFFAOYSA-N.

Identity
Molecular formulaC19H22O4
Molecular weight314.4 g/mol
IUPAC namebenzyl 2,4-dihydroxy-6-pentylbenzoate
InChIKeyFURJJYWNPJDYDH-UHFFFAOYSA-N
SMILESCCCCCC1=C(C(=CC(=C1)O)O)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)