CAS 186895-24-9 appears in our catalog under these names: 3-(4-Benzyloxy-3-methoxy-phenyl)-propionic acid ethyl ester, 95%, 3-(4-benzyloxy-3-methoxy-phenyl)-propionic acid ethyl ester, 97%, 3–(4–benzyloxy–3–methoxy–phenyl)–propionic acid ethyl ester, Ethyl 3-[4-(benzyloxy)-3-methoxyphenyl]propanoate, 3-(4-Benzyloxy-3-methoxy-phenyl)-propionic acid ethyl ester. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
Ethyl 3-(3-methoxy-4-phenylmethoxyphenyl)propanoate (CAS 186895-24-9) is a chemical compound with the molecular formula C19H22O4 and a molecular weight of 314.4 g/mol. IUPAC name: ethyl 3-(3-methoxy-4-phenylmethoxyphenyl)propanoate. InChIKey: BTDYMMIKNRYPMQ-UHFFFAOYSA-N.
| Molecular formula | C19H22O4 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | ethyl 3-(3-methoxy-4-phenylmethoxyphenyl)propanoate |
| InChIKey | BTDYMMIKNRYPMQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC1=CC(=C(C=C1)OCC2=CC=CC=C2)OC |
Computed by PubChem (NCBI)