CAS 138858-50-1 is the registry number for 1,4–Anhydro–2,3–bis–O–benzyl–D–arabinitol. Offered by: GLPBio. Available pack sizes: 250mg, 50mg.
[(2R,3R,4R)-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol (CAS 138858-50-1) is a chemical compound with the molecular formula C19H22O4 and a molecular weight of 314.4 g/mol. IUPAC name: [(2R,3R,4R)-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol. InChIKey: HTCVHCRDBICDRM-GUDVDZBRSA-N.
| Molecular formula | C19H22O4 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | [(2R,3R,4R)-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol |
| InChIKey | HTCVHCRDBICDRM-GUDVDZBRSA-N |
| SMILES | C1[C@H]([C@@H]([C@H](O1)CO)OCC2=CC=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)